C15H24F3IN4O3S2 — CID 109474912
1-ethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474912) has the molecular formula C15H24F3IN4O3S2 and a molecular weight of 556.41 g/mol. Its IUPAC name is 1-ethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474912 |
| Molecular Formula | C15H24F3IN4O3S2 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | 1-ethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCOCC2)s1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H23F3N4O3S2.HI/c1-2-19-14(20-6-5-15(16,17)18)21-11-12-3-4-13(26-12)27(23,24)22-7-9-25-10-8-22;/h3-4H,2,5-11H2,1H3,(H2,19,20,21);1H |
| InChIKey | GEEOUGCEPOEOKQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|