C16H25F3IN5O — CID 109473798
1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473798) has the molecular formula C16H25F3IN5O and a molecular weight of 487.31 g/mol. Its IUPAC name is 1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473798 |
| Molecular Formula | C16H25F3IN5O |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C16H24F3N5O.HI/c1-2-20-15(22-7-5-16(17,18)19)23-12-13-4-3-6-21-14(13)24-8-10-25-11-9-24;/h3-4,6H,2,5,7-12H2,1H3,(H2,20,22,23);1H |
| InChIKey | WMZRXRLMUOBQQQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|