C19H29IN6OS — CID 111934622
1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111934622) has the molecular formula C19H29IN6OS and a molecular weight of 516.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111934622 |
| Molecular Formula | C19H29IN6OS |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C19H28N6OS.HI/c1-3-20-19(22-8-6-17-14-27-15(2)24-17)23-13-16-5-4-7-21-18(16)25-9-11-26-12-10-25;/h4-5,7,14H,3,6,8-13H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | HJUNEIFOMSNTDW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|