C17H20N2O3S2 — CID 53066366
N-(3,4-dimethylphenyl)-5-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 53066366) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-5-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53066366 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(S(=O)(=O)N3CCCC3)s2)cc1C |
| InChI | InChI=1S/C17H20N2O3S2/c1-12-5-6-14(11-13(12)2)18-17(20)15-7-8-16(23-15)24(21,22)19-9-3-4-10-19/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,20) |
| InChIKey | MFNXSLMLFMIUGU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |