C12H20IN3O3S2 — CID 120662205
2-methyl-N'-[(5-methylsulfonylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120662205) has the molecular formula C12H20IN3O3S2 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-methyl-N'-[(5-methylsulfonylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[(5-methylsulfonylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120662205 |
| Molecular Formula | C12H20IN3O3S2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 2-methyl-N'-[(5-methylsulfonylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/Cc2ccc(S(C)(=O)=O)s2)CCO1.I |
| InChI | InChI=1S/C12H19N3O3S2.HI/c1-9-8-15(5-6-18-9)12(13)14-7-10-3-4-11(19-10)20(2,16)17;/h3-4,9H,5-8H2,1-2H3,(H2,13,14);1H |
| InChIKey | VIIQGQUTQHRHSK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|