C12H19ClN4O3S2 — CID 120661936
N'-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120661936) has the molecular formula C12H19ClN4O3S2 and a molecular weight of 366.90 g/mol. Its IUPAC name is N'-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-2-methylmorpholine-4-carboximidamide.
| Compound Name | N'-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661936 |
| Molecular Formula | C12H19ClN4O3S2 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N'-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CCNS(=O)(=O)c2ccc(Cl)s2)CCO1 |
| InChI | InChI=1S/C12H19ClN4O3S2/c1-9-8-17(6-7-20-9)12(14)15-4-5-16-22(18,19)11-3-2-10(13)21-11/h2-3,9,16H,4-8H2,1H3,(H2,14,15) |
| InChIKey | OWJJOPVHEYEXOR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|