C12H26N4O — CID 120661618
N'-[2-(tert-butylamino)ethyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120661618) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is N'-[2-(tert-butylamino)ethyl]-2-methylmorpholine-4-carboximidamide.
| Compound Name | N'-[2-(tert-butylamino)ethyl]-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661618 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | N'-[2-(tert-butylamino)ethyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CCNC(C)(C)C)CCO1 |
| InChI | InChI=1S/C12H26N4O/c1-10-9-16(7-8-17-10)11(13)14-5-6-15-12(2,3)4/h10,15H,5-9H2,1-4H3,(H2,13,14) |
| InChIKey | OKFXGHBSUSMFAD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|