C12H25IN4O2 — CID 120661115
2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]-N-tert-butylacetamide;hydroiodide (PubChem CID 120661115) has the molecular formula C12H25IN4O2 and a molecular weight of 384.26 g/mol. Its IUPAC name is 2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]-N-tert-butylacetamide;hydroiodide.
| Compound Name | 2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]-N-tert-butylacetamide;hydroiodide |
|---|---|
| PubChem CID | 120661115 |
| Molecular Formula | C12H25IN4O2 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]-N-tert-butylacetamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/CC(=O)NC(C)(C)C)CCO1.I |
| InChI | InChI=1S/C12H24N4O2.HI/c1-9-8-16(5-6-18-9)11(13)14-7-10(17)15-12(2,3)4;/h9H,5-8H2,1-4H3,(H2,13,14)(H,15,17);1H |
| InChIKey | BRPCHPNBXZDHLC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|