C13H25IN4O3 — CID 120661307
4-[[[amino-(2-methylmorpholin-4-yl)methylidene]amino]methyl]oxane-4-carboxamide;hydroiodide (PubChem CID 120661307) has the molecular formula C13H25IN4O3 and a molecular weight of 412.27 g/mol. Its IUPAC name is 4-[[[amino-(2-methylmorpholin-4-yl)methylidene]amino]methyl]oxane-4-carboxamide;hydroiodide.
| Compound Name | 4-[[[amino-(2-methylmorpholin-4-yl)methylidene]amino]methyl]oxane-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 120661307 |
| Molecular Formula | C13H25IN4O3 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 4-[[[amino-(2-methylmorpholin-4-yl)methylidene]amino]methyl]oxane-4-carboxamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/CC2(C(N)=O)CCOCC2)CCO1.I |
| InChI | InChI=1S/C13H24N4O3.HI/c1-10-8-17(4-7-20-10)12(15)16-9-13(11(14)18)2-5-19-6-3-13;/h10H,2-9H2,1H3,(H2,14,18)(H2,15,16);1H |
| InChIKey | DWFYEPZYAKTFKE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|