C11H17ClN2O5S3 — CID 110345680
5-chloro-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide (PubChem CID 110345680) has the molecular formula C11H17ClN2O5S3 and a molecular weight of 388.92 g/mol. Its IUPAC name is 5-chloro-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110345680 |
| Molecular Formula | C11H17ClN2O5S3 |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 5-chloro-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide |
| SMILES | CC1COCCN1S(=O)(=O)CCNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H17ClN2O5S3/c1-9-8-19-6-5-14(9)21(15,16)7-4-13-22(17,18)11-3-2-10(12)20-11/h2-3,9,13H,4-8H2,1H3 |
| InChIKey | BXPJWTJISVNCEA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |