C13H22N2O5S3 — CID 110345679
5-ethyl-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide (PubChem CID 110345679) has the molecular formula C13H22N2O5S3 and a molecular weight of 382.53 g/mol. Its IUPAC name is 5-ethyl-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110345679 |
| Molecular Formula | C13H22N2O5S3 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 5-ethyl-N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCS(=O)(=O)N2CCOCC2C)s1 |
| InChI | InChI=1S/C13H22N2O5S3/c1-3-12-4-5-13(21-12)23(18,19)14-6-9-22(16,17)15-7-8-20-10-11(15)2/h4-5,11,14H,3,6-10H2,1-2H3 |
| InChIKey | RYFZDLVAVPRAFY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |