C11H24N2O5S2 — CID 110345658
N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]butane-1-sulfonamide (PubChem CID 110345658) has the molecular formula C11H24N2O5S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110345658 |
| Molecular Formula | C11H24N2O5S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[2-(3-methylmorpholin-4-yl)sulfonylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCS(=O)(=O)N1CCOCC1C |
| InChI | InChI=1S/C11H24N2O5S2/c1-3-4-8-19(14,15)12-5-9-20(16,17)13-6-7-18-10-11(13)2/h11-12H,3-10H2,1-2H3 |
| InChIKey | XGEZUPQZHOOKDR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |