C11H17ClN2O4S3 — CID 110345807
5-chloro-N-[2-(cyclopentylsulfamoyl)ethyl]thiophene-2-sulfonamide (PubChem CID 110345807) has the molecular formula C11H17ClN2O4S3 and a molecular weight of 372.92 g/mol. Its IUPAC name is 5-chloro-N-[2-(cyclopentylsulfamoyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(cyclopentylsulfamoyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110345807 |
| Molecular Formula | C11H17ClN2O4S3 |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 5-chloro-N-[2-(cyclopentylsulfamoyl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(CCNS(=O)(=O)c1ccc(Cl)s1)NC1CCCC1 |
| InChI | InChI=1S/C11H17ClN2O4S3/c12-10-5-6-11(19-10)21(17,18)13-7-8-20(15,16)14-9-3-1-2-4-9/h5-6,9,13-14H,1-4,7-8H2 |
| InChIKey | AVNRAUDSMJLVSI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |