C13H20ClIN4O2 — CID 120661861
N'-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylmorpholine-4-carboximidamide;hydroiodide (PubChem CID 120661861) has the molecular formula C13H20ClIN4O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is N'-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylmorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661861 |
| Molecular Formula | C13H20ClIN4O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N'-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/CCOc2ccc(Cl)cn2)CCO1.I |
| InChI | InChI=1S/C13H19ClN4O2.HI/c1-10-9-18(5-7-19-10)13(15)16-4-6-20-12-3-2-11(14)8-17-12;/h2-3,8,10H,4-7,9H2,1H3,(H2,15,16);1H |
| InChIKey | HINDLGZHTHVYMP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|