C17H21ClN4OS — CID 120661286
N'-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]methyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120661286) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is N'-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]methyl]-2-methylmorpholine-4-carboximidamide.
| Compound Name | N'-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]methyl]-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661286 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N'-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]methyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | Cc1sc(C/N=C(\N)N2CCOC(C)C2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4OS/c1-11-10-22(7-8-23-11)17(19)20-9-15-21-16(12(2)24-15)13-3-5-14(18)6-4-13/h3-6,11H,7-10H2,1-2H3,(H2,19,20) |
| InChIKey | INMOPLAZQAOLDL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|