C13H23IN4S — CID 111817351
N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111817351) has the molecular formula C13H23IN4S and a molecular weight of 394.33 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111817351 |
| Molecular Formula | C13H23IN4S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | Cc1nc(C/N=C(\N)N2CCCC(C)C2)sc1C.I |
| InChI | InChI=1S/C13H22N4S.HI/c1-9-5-4-6-17(8-9)13(14)15-7-12-16-10(2)11(3)18-12;/h9H,4-8H2,1-3H3,(H2,14,15);1H |
| InChIKey | PCBFHXOMPMEOOS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|