C16H20N4O2 — CID 120661374
2-methyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]morpholine-4-carboximidamide (PubChem CID 120661374) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-methyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]morpholine-4-carboximidamide.
| Compound Name | 2-methyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661374 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-methyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]morpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/Cc2cc(-c3ccccc3)on2)CCO1 |
| InChI | InChI=1S/C16H20N4O2/c1-12-11-20(7-8-21-12)16(17)18-10-14-9-15(22-19-14)13-5-3-2-4-6-13/h2-6,9,12H,7-8,10-11H2,1H3,(H2,17,18) |
| InChIKey | RJMLYQIKWWQYAU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|