C14H19IN4O2S — CID 120661143
2-methyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661143) has the molecular formula C14H19IN4O2S and a molecular weight of 434.30 g/mol. Its IUPAC name is 2-methyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661143 |
| Molecular Formula | C14H19IN4O2S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-methyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/Cc2coc(-c3cccs3)n2)CCO1.I |
| InChI | InChI=1S/C14H18N4O2S.HI/c1-10-8-18(4-5-19-10)14(15)16-7-11-9-20-13(17-11)12-3-2-6-21-12;/h2-3,6,9-10H,4-5,7-8H2,1H3,(H2,15,16);1H |
| InChIKey | HJXHNGUOGZZVOY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|