C19H20FN5OS — CID 111038418
4-(4-fluorophenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111038418) has the molecular formula C19H20FN5OS and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111038418 |
| Molecular Formula | C19H20FN5OS |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1coc(-c2cccs2)n1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20FN5OS/c20-14-3-5-16(6-4-14)24-7-9-25(10-8-24)19(21)22-12-15-13-26-18(23-15)17-2-1-11-27-17/h1-6,11,13H,7-10,12H2,(H2,21,22) |
| InChIKey | LLLLJCABNXAOHH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|