C22H27IN4O2S — CID 111731984
N-ethyl-3-(4-methoxyphenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111731984) has the molecular formula C22H27IN4O2S and a molecular weight of 538.46 g/mol. Its IUPAC name is N-ethyl-3-(4-methoxyphenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(4-methoxyphenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111731984 |
| Molecular Formula | C22H27IN4O2S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | N-ethyl-3-(4-methoxyphenyl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)N1CCC(c2ccc(OC)cc2)C1.I |
| InChI | InChI=1S/C22H26N4O2S.HI/c1-3-23-22(24-13-18-15-28-21(25-18)20-5-4-12-29-20)26-11-10-17(14-26)16-6-8-19(27-2)9-7-16;/h4-9,12,15,17H,3,10-11,13-14H2,1-2H3,(H,23,24);1H |
| InChIKey | XUSKAVHUVVAPRY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|