C11H17BrIN3OS — CID 120661477
N'-[(3-bromothiophen-2-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide (PubChem CID 120661477) has the molecular formula C11H17BrIN3OS and a molecular weight of 446.15 g/mol. Its IUPAC name is N'-[(3-bromothiophen-2-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-bromothiophen-2-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661477 |
| Molecular Formula | C11H17BrIN3OS |
| Molecular Weight | 446.15 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | N'-[(3-bromothiophen-2-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/Cc2sccc2Br)CCO1.I |
| InChI | InChI=1S/C11H16BrN3OS.HI/c1-8-7-15(3-4-16-8)11(13)14-6-10-9(12)2-5-17-10;/h2,5,8H,3-4,6-7H2,1H3,(H2,13,14);1H |
| InChIKey | RFIIQJGVUCPOMD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|