C14H20F3IN4O2 — CID 120661971
2-methyl-N'-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661971) has the molecular formula C14H20F3IN4O2 and a molecular weight of 460.24 g/mol. Its IUPAC name is 2-methyl-N'-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661971 |
| Molecular Formula | C14H20F3IN4O2 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 2-methyl-N'-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/CCOc2cccc(C(F)(F)F)n2)CCO1.I |
| InChI | InChI=1S/C14H19F3N4O2.HI/c1-10-9-21(6-8-22-10)13(18)19-5-7-23-12-4-2-3-11(20-12)14(15,16)17;/h2-4,10H,5-9H2,1H3,(H2,18,19);1H |
| InChIKey | AXRIRQHFZINYGG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|