C14H20IN7O2S2 — CID 119117372
4-pyrimidin-2-yl-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 119117372) has the molecular formula C14H20IN7O2S2 and a molecular weight of 509.40 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-pyrimidin-2-yl-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119117372 |
| Molecular Formula | C14H20IN7O2S2 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | 4-pyrimidin-2-yl-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H19N7O2S2.HI/c15-13(19-10-11-2-3-12(24-11)25(16,22)23)20-6-8-21(9-7-20)14-17-4-1-5-18-14;/h1-5H,6-10H2,(H2,15,19)(H2,16,22,23);1H |
| InChIKey | SIDXOJZCPKTBEJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|