C12H20IN3S — CID 111046068
N'-[(5-methylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111046068) has the molecular formula C12H20IN3S and a molecular weight of 365.28 g/mol. Its IUPAC name is N'-[(5-methylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-methylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111046068 |
| Molecular Formula | C12H20IN3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N'-[(5-methylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | Cc1ccc(C/N=C(\N)N2CCCCC2)s1.I |
| InChI | InChI=1S/C12H19N3S.HI/c1-10-5-6-11(16-10)9-14-12(13)15-7-3-2-4-8-15;/h5-6H,2-4,7-9H2,1H3,(H2,13,14);1H |
| InChIKey | GYTYJUQXIGPBCS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|