C16H21N3O — CID 111814282
N'-[(3-methyl-1-benzofuran-2-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111814282) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N'-[(3-methyl-1-benzofuran-2-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N'-[(3-methyl-1-benzofuran-2-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111814282 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N'-[(3-methyl-1-benzofuran-2-yl)methyl]piperidine-1-carboximidamide |
| SMILES | Cc1c(C/N=C(\N)N2CCCCC2)oc2ccccc12 |
| InChI | InChI=1S/C16H21N3O/c1-12-13-7-3-4-8-14(13)20-15(12)11-18-16(17)19-9-5-2-6-10-19/h3-4,7-8H,2,5-6,9-11H2,1H3,(H2,17,18) |
| InChIKey | QWZZDKPPCDZOLY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|