C26H32N4O2 — CID 111602601
1-ethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 111602601) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-ethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111602601 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 1-ethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)N2CCCCC2)c1)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C26H32N4O2/c1-3-27-26(29-18-24-19(2)22-12-5-6-13-23(22)32-24)28-17-20-10-9-11-21(16-20)25(31)30-14-7-4-8-15-30/h5-6,9-13,16H,3-4,7-8,14-15,17-18H2,1-2H3,(H2,27,28,29) |
| InChIKey | VSIROOGAWSEPHK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|