C26H34N4O2 — CID 111562698
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 111562698) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111562698 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[[3-(piperidine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)N2CCCCC2)c1)NCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C26H34N4O2/c1-2-27-26(28-13-11-20-9-10-24-22(17-20)12-16-32-24)29-19-21-7-6-8-23(18-21)25(31)30-14-4-3-5-15-30/h6-10,17-18H,2-5,11-16,19H2,1H3,(H2,27,28,29) |
| InChIKey | GNZNINDZOTZFPL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|