C16H24IN3O — CID 111814257
2-[(3-methyl-1-benzofuran-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 111814257) has the molecular formula C16H24IN3O and a molecular weight of 401.29 g/mol. Its IUPAC name is 2-[(3-methyl-1-benzofuran-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-methyl-1-benzofuran-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111814257 |
| Molecular Formula | C16H24IN3O |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[(3-methyl-1-benzofuran-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | Cc1c(C/N=C(\N)NCCC(C)C)oc2ccccc12.I |
| InChI | InChI=1S/C16H23N3O.HI/c1-11(2)8-9-18-16(17)19-10-15-12(3)13-6-4-5-7-14(13)20-15;/h4-7,11H,8-10H2,1-3H3,(H3,17,18,19);1H |
| InChIKey | SODJATNTEMZHQH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|