C10H14N2S — CID 63176240
N'-[(5-methylthiophen-2-yl)methyl]cyclopropanecarboximidamide (PubChem CID 63176240) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is N'-[(5-methylthiophen-2-yl)methyl]cyclopropanecarboximidamide.
| Compound Name | N'-[(5-methylthiophen-2-yl)methyl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 63176240 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N'-[(5-methylthiophen-2-yl)methyl]cyclopropanecarboximidamide |
| SMILES | Cc1ccc(C/N=C(\N)C2CC2)s1 |
| InChI | InChI=1S/C10H14N2S/c1-7-2-5-9(13-7)6-12-10(11)8-3-4-8/h2,5,8H,3-4,6H2,1H3,(H2,11,12) |
| InChIKey | WLPXHPLDYBNZOQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|