C10H13ClN2S — CID 106043235
N'-[2-(5-chlorothiophen-2-yl)ethyl]cyclopropanecarboximidamide (PubChem CID 106043235) has the molecular formula C10H13ClN2S and a molecular weight of 228.75 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)ethyl]cyclopropanecarboximidamide.
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)ethyl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 106043235 |
| Molecular Formula | C10H13ClN2S |
| Molecular Weight | 228.75 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)ethyl]cyclopropanecarboximidamide |
| SMILES | N/C(=N\CCc1ccc(Cl)s1)C1CC1 |
| InChI | InChI=1S/C10H13ClN2S/c11-9-4-3-8(14-9)5-6-13-10(12)7-1-2-7/h3-4,7H,1-2,5-6H2,(H2,12,13) |
| InChIKey | BWWWNYVXWQQZKN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|