C10H16N4S2 — CID 111078321
N'-[(2-methyl-1,3-thiazol-5-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111078321) has the molecular formula C10H16N4S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-thiazol-5-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(2-methyl-1,3-thiazol-5-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111078321 |
| Molecular Formula | C10H16N4S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N'-[(2-methyl-1,3-thiazol-5-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | Cc1ncc(C/N=C(\N)N2CCSCC2)s1 |
| InChI | InChI=1S/C10H16N4S2/c1-8-12-6-9(16-8)7-13-10(11)14-2-4-15-5-3-14/h6H,2-5,7H2,1H3,(H2,11,13) |
| InChIKey | IUAPWFNZYPPXLL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|