C10H18N6S — CID 120663168
N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 120663168) has the molecular formula C10H18N6S and a molecular weight of 254.36 g/mol. Its IUPAC name is N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120663168 |
| Molecular Formula | C10H18N6S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCn1ncnc1C/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C10H18N6S/c1-2-16-9(13-8-14-16)7-12-10(11)15-3-5-17-6-4-15/h8H,2-7H2,1H3,(H2,11,12) |
| InChIKey | FGMWYYWQMIOLNL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|