C14H21N3S — CID 111051638
N'-[(2,4-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111051638) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N'-[(2,4-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(2,4-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111051638 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N'-[(2,4-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | Cc1ccc(C/N=C(\N)N2CCSCC2)c(C)c1 |
| InChI | InChI=1S/C14H21N3S/c1-11-3-4-13(12(2)9-11)10-16-14(15)17-5-7-18-8-6-17/h3-4,9H,5-8,10H2,1-2H3,(H2,15,16) |
| InChIKey | KFXLMEWTENQXLC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|