C14H19N5S — CID 119119846
N'-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 119119846) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is N'-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 119119846 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N'-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | Cc1ccn2cc(C/N=C(\N)N3CCSCC3)nc2c1 |
| InChI | InChI=1S/C14H19N5S/c1-11-2-3-19-10-12(17-13(19)8-11)9-16-14(15)18-4-6-20-7-5-18/h2-3,8,10H,4-7,9H2,1H3,(H2,15,16) |
| InChIKey | VMPLSNONFDYTBP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|