C16H21IN4OS — CID 111813933
N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111813933) has the molecular formula C16H21IN4OS and a molecular weight of 444.34 g/mol. Its IUPAC name is N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111813933 |
| Molecular Formula | C16H21IN4OS |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1ccc(-c2nc(C/N=C(\N)N3CCSCC3)co2)cc1.I |
| InChI | InChI=1S/C16H20N4OS.HI/c1-12-2-4-13(5-3-12)15-19-14(11-21-15)10-18-16(17)20-6-8-22-9-7-20;/h2-5,11H,6-10H2,1H3,(H2,17,18);1H |
| InChIKey | VRYVUPWJRWNXKF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|