C16H23IN4O2 — CID 111813905
1-(1-methoxypropan-2-yl)-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111813905) has the molecular formula C16H23IN4O2 and a molecular weight of 430.29 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813905 |
| Molecular Formula | C16H23IN4O2 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/Cc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C16H22N4O2.HI/c1-11-4-6-13(7-5-11)15-20-14(10-22-15)8-18-16(17)19-12(2)9-21-3;/h4-7,10,12H,8-9H2,1-3H3,(H3,17,18,19);1H |
| InChIKey | UPZUPSNEFFCHNR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|