C17H23FN4O2 — CID 111235209
1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine (PubChem CID 111235209) has the molecular formula C17H23FN4O2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine.
| Compound Name | 1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111235209 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
| SMILES | C/N=C(/NCCc1coc(-c2ccc(F)cc2)n1)NC(C)COC |
| InChI | InChI=1S/C17H23FN4O2/c1-12(10-23-3)21-17(19-2)20-9-8-15-11-24-16(22-15)13-4-6-14(18)7-5-13/h4-7,11-12H,8-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | WCCAWXNDVZBWSV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|