C20H23FN4OS — CID 111957163
1-[(5-ethylthiophen-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine (PubChem CID 111957163) has the molecular formula C20H23FN4OS and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111957163 |
| Molecular Formula | C20H23FN4OS |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine |
| SMILES | CCc1ccc(CN/C(=N\C)NCCc2coc(-c3ccc(F)cc3)n2)s1 |
| InChI | InChI=1S/C20H23FN4OS/c1-3-17-8-9-18(27-17)12-24-20(22-2)23-11-10-16-13-26-19(25-16)14-4-6-15(21)7-5-14/h4-9,13H,3,10-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | YXTJTYMOHFHJBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|