C19H22FN5OS — CID 111535720
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine (PubChem CID 111535720) has the molecular formula C19H22FN5OS and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111535720 |
| Molecular Formula | C19H22FN5OS |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCCc2coc(-c3ccc(F)cc3)n2)s1 |
| InChI | InChI=1S/C19H22FN5OS/c1-3-16-10-23-17(27-16)11-24-19(21-2)22-9-8-15-12-26-18(25-15)13-4-6-14(20)7-5-13/h4-7,10,12H,3,8-9,11H2,1-2H3,(H2,21,22,24) |
| InChIKey | PBUWKVJFNFNKSL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|