C8H13N3S — CID 63176642
N'-[(2-methyl-1,3-thiazol-5-yl)methyl]propanimidamide (PubChem CID 63176642) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-thiazol-5-yl)methyl]propanimidamide.
| Compound Name | N'-[(2-methyl-1,3-thiazol-5-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 63176642 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N'-[(2-methyl-1,3-thiazol-5-yl)methyl]propanimidamide |
| SMILES | CC/C(N)=N\Cc1cnc(C)s1 |
| InChI | InChI=1S/C8H13N3S/c1-3-8(9)11-5-7-4-10-6(2)12-7/h4H,3,5H2,1-2H3,(H2,9,11) |
| InChIKey | FGEOLWJZOLHMDE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|