C9H17IN4S — CID 110912278
2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-propan-2-ylguanidine;hydroiodide (PubChem CID 110912278) has the molecular formula C9H17IN4S and a molecular weight of 340.23 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-propan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110912278 |
| Molecular Formula | C9H17IN4S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
| SMILES | Cc1ncc(C/N=C(\N)NC(C)C)s1.I |
| InChI | InChI=1S/C9H16N4S.HI/c1-6(2)13-9(10)12-5-8-4-11-7(3)14-8;/h4,6H,5H2,1-3H3,(H3,10,12,13);1H |
| InChIKey | CJQYJVDLUIFOLQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|