C10H17N3OS — CID 110747788
1-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]-3-propan-2-ylurea (PubChem CID 110747788) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 110747788 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]-3-propan-2-ylurea |
| SMILES | Cc1ncc(CCNC(=O)NC(C)C)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-7(2)13-10(14)11-5-4-9-6-12-8(3)15-9/h6-7H,4-5H2,1-3H3,(H2,11,13,14) |
| InChIKey | RZTBNJCJORSLTF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |