C12H24IN3O3 — CID 110062039
propan-2-yl 4-[[amino(morpholin-4-yl)methylidene]amino]butanoate;hydroiodide (PubChem CID 110062039) has the molecular formula C12H24IN3O3 and a molecular weight of 385.25 g/mol. Its IUPAC name is propan-2-yl 4-[[amino(morpholin-4-yl)methylidene]amino]butanoate;hydroiodide.
| Compound Name | propan-2-yl 4-[[amino(morpholin-4-yl)methylidene]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 110062039 |
| Molecular Formula | C12H24IN3O3 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | propan-2-yl 4-[[amino(morpholin-4-yl)methylidene]amino]butanoate;hydroiodide |
| SMILES | CC(C)OC(=O)CCC/N=C(\N)N1CCOCC1.I |
| InChI | InChI=1S/C12H23N3O3.HI/c1-10(2)18-11(16)4-3-5-14-12(13)15-6-8-17-9-7-15;/h10H,3-9H2,1-2H3,(H2,13,14);1H |
| InChIKey | YPEBIEVOJYCOMC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|