C11H22IN3O2S — CID 111037125
propan-2-yl 3-[[amino(thiomorpholin-4-yl)methylidene]amino]propanoate;hydroiodide (PubChem CID 111037125) has the molecular formula C11H22IN3O2S and a molecular weight of 387.29 g/mol. Its IUPAC name is propan-2-yl 3-[[amino(thiomorpholin-4-yl)methylidene]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[amino(thiomorpholin-4-yl)methylidene]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111037125 |
| Molecular Formula | C11H22IN3O2S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | propan-2-yl 3-[[amino(thiomorpholin-4-yl)methylidene]amino]propanoate;hydroiodide |
| SMILES | CC(C)OC(=O)CC/N=C(\N)N1CCSCC1.I |
| InChI | InChI=1S/C11H21N3O2S.HI/c1-9(2)16-10(15)3-4-13-11(12)14-5-7-17-8-6-14;/h9H,3-8H2,1-2H3,(H2,12,13);1H |
| InChIKey | KKKCRCQDGJVMPP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|