C7H17IN4O2S2 — CID 111046624
N'-(2-sulfamoylethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111046624) has the molecular formula C7H17IN4O2S2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N'-(2-sulfamoylethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(2-sulfamoylethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111046624 |
| Molecular Formula | C7H17IN4O2S2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | N'-(2-sulfamoylethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCS(N)(=O)=O)N1CCSCC1 |
| InChI | InChI=1S/C7H16N4O2S2.HI/c8-7(10-1-6-15(9,12)13)11-2-4-14-5-3-11;/h1-6H2,(H2,8,10)(H2,9,12,13);1H |
| InChIKey | OFKRLXGKVONNNK-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|