C12H25IN4OS — CID 75493964
3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 75493964) has the molecular formula C12H25IN4OS and a molecular weight of 400.33 g/mol. Its IUPAC name is 3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 75493964 |
| Molecular Formula | C12H25IN4OS |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN(CC)C(=O)CC/N=C(\N)N1CCSCC1.I |
| InChI | InChI=1S/C12H24N4OS.HI/c1-3-15(4-2)11(17)5-6-14-12(13)16-7-9-18-10-8-16;/h3-10H2,1-2H3,(H2,13,14);1H |
| InChIKey | FHIQIMVIEKMFMF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|