C11H19N5OS — CID 111600825
N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]morpholine-4-carboximidamide (PubChem CID 111600825) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111600825 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]morpholine-4-carboximidamide |
| SMILES | CN(C)c1nc(C/N=C(\N)N2CCOCC2)cs1 |
| InChI | InChI=1S/C11H19N5OS/c1-15(2)11-14-9(8-18-11)7-13-10(12)16-3-5-17-6-4-16/h8H,3-7H2,1-2H3,(H2,12,13) |
| InChIKey | HOPRNCJGQVIJKS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|