C14H21N7S2 — CID 111600781
N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111600781) has the molecular formula C14H21N7S2 and a molecular weight of 351.51 g/mol. Its IUPAC name is N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111600781 |
| Molecular Formula | C14H21N7S2 |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N'-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CN(C)c1nc(C/N=C(\N)N2CCN(c3nccs3)CC2)cs1 |
| InChI | InChI=1S/C14H21N7S2/c1-19(2)14-18-11(10-23-14)9-17-12(15)20-4-6-21(7-5-20)13-16-3-8-22-13/h3,8,10H,4-7,9H2,1-2H3,(H2,15,17) |
| InChIKey | ORMDEEONJRGUHD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|