C21H21N5O2 — CID 135468143
N'-[4-(2-hydroxyphenyl)-6-phenylpyrimidin-2-yl]morpholine-4-carboximidamide (PubChem CID 135468143) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N'-[4-(2-hydroxyphenyl)-6-phenylpyrimidin-2-yl]morpholine-4-carboximidamide.
| Compound Name | N'-[4-(2-hydroxyphenyl)-6-phenylpyrimidin-2-yl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 135468143 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N'-[4-(2-hydroxyphenyl)-6-phenylpyrimidin-2-yl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\c1nc(-c2ccccc2)cc(-c2ccccc2O)n1)N1CCOCC1 |
| InChI | InChI=1S/C21H21N5O2/c22-20(26-10-12-28-13-11-26)25-21-23-17(15-6-2-1-3-7-15)14-18(24-21)16-8-4-5-9-19(16)27/h1-9,14,27H,10-13H2,(H2,22,23,24,25) |
| InChIKey | WHBNUNMKQMGUSX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|