C51H59N9O4 — CID 157157846
2-(5-methoxy-2-phenylphenyl)-1,1-dimethylguanidine;N'-(5-methoxy-2-phenylphenyl)morpholine-4-carboximidamide;N'-(2-phenylphenyl)morpholine-4-carboximidamide (PubChem CID 157157846) has the molecular formula C51H59N9O4 and a molecular weight of 862.09 g/mol. Its IUPAC name is 2-(5-methoxy-2-phenylphenyl)-1,1-dimethylguanidine;N'-(5-methoxy-2-phenylphenyl)morpholine-4-carboximidamide;N'-(2-phenylphenyl)morpholine-4-carboximidamide.
| Compound Name | 2-(5-methoxy-2-phenylphenyl)-1,1-dimethylguanidine;N'-(5-methoxy-2-phenylphenyl)morpholine-4-carboximidamide;N'-(2-phenylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 157157846 |
| Molecular Formula | C51H59N9O4 |
| Molecular Weight | 862.09 g/mol |
| Exact Mass | 861.47 |
| IUPAC Name | 2-(5-methoxy-2-phenylphenyl)-1,1-dimethylguanidine;N'-(5-methoxy-2-phenylphenyl)morpholine-4-carboximidamide;N'-(2-phenylphenyl)morpholine-4-carboximidamide |
| SMILES | COc1ccc(-c2ccccc2)c(/N=C(\N)N(C)C)c1.COc1ccc(-c2ccccc2)c(/N=C(\N)N2CCOCC2)c1.N/C(=N\c1ccccc1-c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H21N3O2.C17H19N3O.C16H19N3O/c1-22-15-7-8-16(14-5-3-2-4-6-14)17(13-15)20-18(19)21-9-11-23-12-10-21;18-17(20-10-12-21-13-11-20)19-16-9-5-4-8-15(16)14-6-2-1-3-7-14;1-19(2)16(17)18-15-11-13(20-3)9-10-14(15)12-7-5-4-6-8-12/h2-8,13H,9-12H2,1H3,(H2,19,20);1-9H,10-13H2,(H2,18,19);4-11H,1-3H3,(H2,17,18) |
| InChIKey | AMAIDCAFNPXFQW-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.09 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|